9-Ethynylphenanthrene
- Product Name9-Ethynylphenanthrene
- CAS32870-98-7
- MFC16H10
- MW202.25
- EINECS628-471-3
- MOL File32870-98-7.mol
Chemical Properties
| Melting point | 63-67 °C (lit.) |
| Boiling point | 377.7±11.0 °C(Predicted) |
| Density | 1.15±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | InChI=1S/C16H10/c1-2-12-11-13-7-3-4-9-15(13)16-10-6-5-8-14(12)16/h1,3-11H |
| InChIKey | FMKVRRYQWWPOAL-UHFFFAOYSA-N |
| SMILES | C1=C2C(C3C(C(C#C)=C2)=CC=CC=3)=CC=C1 |
| CAS DataBase Reference | 32870-98-7 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HS Code | 2902.90.9000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 Eye Dam. 1 |