RETRORSINE
- Product NameRETRORSINE
- CAS480-54-6
- MFC18H25NO6
- MW351.39
- EINECS610-403-9
- MOL File480-54-6.mol
Chemical Properties
| Melting point | 208-211 °C (lit.) |
| alpha | D18 -17.6° (c = 1.99 in ethanol) |
| Boiling point | 485.2°C (rough estimate) |
| Density | 1.32±0.1 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.5100 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO: Slightly soluble: 0.1-1 mg/mlPBS (pH 7.2): Slightly soluble: 0.1-1 mg/ml |
| form | Solid |
| pka | 12.00±0.40(Predicted) |
| color | White to off-white |
| Merck | 13,8253 |
| Major Application | food and beverages |
| InChI | InChI=1S/C18H25NO6/c1-3-12-8-11(2)18(23,10-20)17(22)24-9-13-4-6-19-7-5-14(15(13)19)25-16(12)21/h3-4,11,14-15,20,23H,5-10H2,1-2H3/b12-3-/t11-,14-,15-,18-/m1/s1 |
| InChIKey | BCJMNZRQJAVDLD-VMOBWIEOSA-N |
| SMILES | N12CC=C3COC(=O)[C@@](O)(CO)[C@H](C)C/C(=C/C)/C(=O)O[C@@]([H])([C@]13[H])CC2 |
| CAS DataBase Reference | 480-54-6 |
| IARC | 3 (Vol. 10, Sup 7) 1987 |
| EPA Substance Registry System | Retrorsine (480-54-6) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 22-36/37/39-45 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| RTECS | VH7525000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral |
| Hazardous Substances Data | 480-54-6(Hazardous Substances Data) |