4-(1,1,2,2-Tetrafluoroethoxy)benzoic acid
- Product Name4-(1,1,2,2-Tetrafluoroethoxy)benzoic acid
- CAS10009-25-3
- MFC9H6F4O3
- MW238.14
- EINECS
- MOL File10009-25-3.mol
Chemical Properties
| Melting point | 175-179 °C (lit.) |
| Boiling point | 275.3±40.0 °C(Predicted) |
| Density | 1.446±0.06 g/cm3(Predicted) |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.95±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | 1S/C9H6F4O3/c10-8(11)9(12,13)16-6-3-1-5(2-4-6)7(14)15/h1-4,8H,(H,14,15) |
| InChIKey | SVGWTILJZWYEMD-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(OC(F)(F)C(F)F)cc1 |
| CAS DataBase Reference | 10009-25-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34-36/37/38 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| HazardClass | CORROSIVE |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
