Benzoic acid pentafluorophenyl ester, BzOPfp
- Product NameBenzoic acid pentafluorophenyl ester, BzOPfp
- CAS1548-84-1
- MFC13H5F5O2
- MW288.17
- EINECS
- MOL File1548-84-1.mol
Chemical Properties
| Melting point | 73-74 °C(lit.) |
| Boiling point | 371.7±42.0 °C(Predicted) |
| Density | 1.486±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C13H5F5O2/c14-7-8(15)10(17)12(11(18)9(7)16)20-13(19)6-4-2-1-3-5-6/h1-5H |
| InChIKey | WZPWTXZSQHIABL-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(OC(=O)c2ccccc2)c(F)c1F || Fc1c(F)c(F)c(OC(=O)c2ccccc2)c(F)c1F |
| CAS DataBase Reference | 1548-84-1 |
Safety Information
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | WGK 3 |
| HS Code | 2916310090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 |