3,6,3-Nonylphenol-13C6, 363-NP-13C6, 4-(1-Ethyl-1,4-dimethylpentyl)phenol-13C6 (ring-13C6)
- Product Name3,6,3-Nonylphenol-13C6, 363-NP-13C6, 4-(1-Ethyl-1,4-dimethylpentyl)phenol-13C6 (ring-13C6)
- CAS1173020-38-6
- MFC15H24O
- MW226.40446
- EINECS687-873-7
- MOL File1173020-38-6.mol
Chemical Properties
| Flash point | -17 °C |
| storage temp. | −20°C |
| solubility | Chloroform (Soluble), Methanol (Sparingly) |
| form | Oil to Thick Oil |
| color | Colourless to Pale Yellow |
| Major Application | environmental |
| InChI | 1S/C15H24O/c1-5-15(4,11-10-12(2)3)13-6-8-14(16)9-7-13/h6-9,12,16H,5,10-11H2,1-4H3/i6+1,7+1,8+1,9+1,13+1,14+1 |
| InChIKey | BGLUSMSXKMBLFS-FQPQTBQFSA-N |
| SMILES | O[13C]1=[13CH][13CH]=[13C](C(CC)(C)CCC(C)C)[13CH]=[13CH]1 |
Safety Information
| Hazard Codes | F,Xi |
| Risk Statements | 11-36-66-67 |
| Safety Statements | 9-16-26 |
| RIDADR | UN 1090 3/PG 2 |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |