DIGOXIGENIN
- Product NameDIGOXIGENIN
- CAS1672-46-4
- MFC23H34O5
- MW390.51
- EINECS216-806-2
- MOL File1672-46-4.mol
Chemical Properties
| Melting point | 222 °C(lit.) |
| Boiling point | 435.71°C (rough estimate) |
| Density | 1.0639 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| storage temp. | room temp |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 14.44±0.70(Predicted) |
| color | White to off-white |
| Merck | 13,3188 |
| BRN | 96479 |
| Henry's Law Constant | 4.3×105 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | environmental food and beverages forensics and toxicology veterinary |
| InChIKey | SHIBSTMRCDJXLN-KCZCNTNESA-N |
| SMILES | C[C@]12CC[C@H](O)C[C@H]1CC[C@@H]3[C@@H]2C[C@@H](O)[C@]4(C)[C@H](CC[C@]34O)C5=CC(=O)OC5 |
| CAS DataBase Reference | 1672-46-4(CAS DataBase Reference) |
| EPA Substance Registry System | Card-20(22)-enolide, 3,12,14-trihydroxy-, (3.beta.,5.beta,12.beta.)- (1672-46-4) |
Safety Information
| Hazard Codes | T+ |
| Risk Statements | 26/27/28 |
| Safety Statements | 36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | FH5390000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 1 Oral Acute Tox. 2 Dermal |
| Hazardous Substances Data | 1672-46-4(Hazardous Substances Data) |
