5-Chloro-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde
- Product Name5-Chloro-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde
- CAS947-95-5
- MFC11H9ClN2O
- MW220.65
- EINECS
- MOL File947-95-5.mol
Chemical Properties
| Melting point | 145-148 °C (lit.) |
| Boiling point | 356.1±37.0 °C(Predicted) |
| Density | 1.26 |
| refractive index | 1.6000 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | -3.81±0.10(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C11H9ClN2O/c1-8-10(7-15)11(12)14(13-8)9-5-3-2-4-6-9/h2-7H,1H3 |
| InChIKey | DKZPJLZXLKAMDO-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=CC=C2)C(Cl)=C(C=O)C(C)=N1 |
| CAS DataBase Reference | 947-95-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29331990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |