| Melting point |
55-58 °C |
| Boiling point |
484.4±45.0 °C(Predicted) |
| Density |
1.174±0.06 g/cm3(Predicted) |
| refractive index |
-6.3 ° (C=5, CHCl3) |
| storage temp. |
2-8°C |
| solubility |
almost transparency in Chloroform |
| form |
powder to crystal |
| pka |
13.24±0.20(Predicted) |
| color |
White to Almost white |
| optical activity |
[α]20/D 6°, c = 5 in chloroform |
| BRN |
2149394 |
| InChI |
1S/C18H22O4/c19-17(13-21-11-15-7-3-1-4-8-15)18(20)14-22-12-16-9-5-2-6-10-16/h1-10,17-20H,11-14H2/t17-,18-/m0/s1 |
| InChIKey |
YAVAVQDYJARRAU-ROUUACIJSA-N |
| SMILES |
O[C@@H](COCc1ccccc1)[C@@H](O)COCc2ccccc2 |
| CAS DataBase Reference |
17401-06-8(CAS DataBase Reference) |
