3-Chloro-4-iodoaniline
- Product Name3-Chloro-4-iodoaniline
- CAS135050-44-1
- MFC6H5ClIN
- MW253.47
- EINECS
- MOL File135050-44-1.mol
Chemical Properties
| Melting point | 65-70 °C |
| Boiling point | 312.8±27.0 °C(Predicted) |
| Density | 1.9011 (estimate) |
| Flash point | 143℃ |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.75±0.10(Predicted) |
| color | White to Amber to Dark purple |
| Sensitive | Light Sensitive |
| BRN | 3236464 |
| InChI | InChI=1S/C6H5ClIN/c7-5-3-4(9)1-2-6(5)8/h1-3H,9H2 |
| InChIKey | ONZHMGRKWJMTDE-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(I)C(Cl)=C1 |
| CAS DataBase Reference | 135050-44-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |