| Melting point |
>200°C (dec.) |
| Boiling point |
462.1±40.0 °C(Predicted) |
| Density |
1.244±0.06 g/cm3(Predicted) |
| storage temp. |
Refrigerator, Under Inert Atmosphere |
| solubility |
DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2)(1:8): 0.11 mg/ml; Ethanol: 2.5 mg/ml |
| form |
A crystalline solid |
| pka |
9.71±0.10(Predicted) |
| color |
White to off-white |
| Major Application |
pharmaceutical (small molecule) |
| InChI |
InChI=1S/C18H15NO2/c20-15-8-4-13(5-9-15)18(17-3-1-2-12-19-17)14-6-10-16(21)11-7-14/h1-12,18,20-21H |
| InChIKey |
LJROKJGQSPMTKB-UHFFFAOYSA-N |
| SMILES |
C(C1=CC=C(O)C=C1)(C1=CC=C(O)C=C1)C1=NC=CC=C1 |
| LogP |
2.31 at 22℃ and pH7 |
