| Melting point |
101-104 °C(lit.) |
| Boiling point |
337.6±37.0 °C(Predicted) |
| Density |
1.729±0.06 g/cm3(Predicted) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
soluble in Toluene |
| form |
powder to crystal |
| color |
Light orange to Yellow to Green |
| Water Solubility |
Insoluble in water. |
| BRN |
1685438 |
| InChI |
1S/C6H2Cl2N2O4/c7-3-1-4(8)6(10(13)14)2-5(3)9(11)12/h1-2H |
| InChIKey |
ZPXDNSYFDIHPOJ-UHFFFAOYSA-N |
| SMILES |
[O-][N+](=O)c1cc(c(Cl)cc1Cl)[N+]([O-])=O |
| CAS DataBase Reference |
3698-83-7(CAS DataBase Reference) |
| NIST Chemistry Reference |
1,3-Dichloro-4,6-dinitrobenzene(3698-83-7) |
| EPA Substance Registry System |
Benzene, 1,5-dichloro-2,4-dinitro- (3698-83-7) |
