(+/-)-trans-1,2-Cyclohexanedicarboxylic anhydride
- Product Name(+/-)-trans-1,2-Cyclohexanedicarboxylic anhydride
- CAS14166-21-3
- MFC8H10O3
- MW154.16
- EINECS238-009-9
- MOL File14166-21-3.mol
Chemical Properties
| Melting point | 145-147 °C(lit.) |
| Boiling point | 283.4±0.0 °C(Predicted) |
| Density | 1.235±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Acetone (Sparingly), Chloroform (Slightly), DMSO (Slightly) |
| form | Solid |
| color | White to Pale Beige |
| Exposure limits | TLV-CEILING: 0.005 mg/m3, Inhalable fraction and vapor |
| Stability | Moisture Sensitive |
| InChI | 1S/C8H10O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h5-6H,1-4H2/t5-,6-/m0/s1 |
| InChIKey | MUTGBJKUEZFXGO-WDSKDSINSA-N |
| SMILES | O=C1OC(=O)[C@H]2CCCC[C@H]12 |
| CAS DataBase Reference | 14166-21-3 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-42/43-41 |
| Safety Statements | 26-27-36/37/39-37/39-24-23 |
| WGK Germany | 3 |
| HS Code | 29172090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
