Chemical Properties
| Melting point | 107-108 °C(lit.) |
| Boiling point | 503.1±50.0 °C(Predicted) |
| Density | 1.1630 (rough estimate) |
| refractive index | 1.6470 (estimate) |
| storage temp. | -20°C |
| solubility | Soluble in DMSO (up to 50 mg/ml) or in Ethanol (up to 15 mg/ml with warming). |
| form | solid |
| pka | 10.74±0.46(Predicted) |
| color | White |
| optical activity | [α]23/D +30°, c = 1 in chloroform |
| Stability | Stable for 2 years from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20° for up to 1 month. |
| Major Application | peptide synthesis |
| InChI | 1S/C18H18ClNO3/c19-12-17(21)16(11-14-7-3-1-4-8-14)20-18(22)23-13-15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,20,22)/t16-/m0/s1 |
| InChIKey | OYHLRJGDELITAF-INIZCTEOSA-N |
| SMILES | ClCC(=O)[C@H](Cc1ccccc1)NC(=O)OCc2ccccc2 |
| CAS DataBase Reference | 26049-94-5 |
| EPA Substance Registry System | Benzyl [(1S)-3-chloro-2-oxo-1-benzylpropyl]carbamate (26049-94-5) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29225000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
