(+)-ALPHA-TERPINEOL
- Product Name(+)-ALPHA-TERPINEOL
- CAS7785-53-7
- MFC10H18O
- MW154.25
- EINECS232-081-5
- MOL File7785-53-7.mol
Chemical Properties
| Boiling point | 72 °C(Press: 4 Torr) |
| Density | 0.94 g/mL at 20 °C(lit.) |
| Flash point | 90 °C |
| storage temp. | 2-8°C |
| pka | 15.09±0.29(Predicted) |
| Odor | at 100.00 %. lilac floral |
| Appearance | Colorless to light yellow Liquid |
| optical activity | [α]/D +90±10°, c = 0.1 in ethanol |
| Odor Type | floral |
| BRN | 2041428 |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C10H18O/c1-8-4-6-9(7-5-8)10(2,3)11/h4,9,11H,5-7H2,1-3H3/t9-/m0/s1 |
| InChIKey | WUOACPNHFRMFPN-VIFPVBQESA-N |
| SMILES | CC1=CC[C@@H](CC1)C(C)(C)O |
| LogP | 2.708 (est) |
| EPA Substance Registry System | 3-Cyclohexene-1-methanol, .alpha.,.alpha.,4-trimethyl-, (1R)- (7785-53-7) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |