4-Chloro-7-chlorosulfonyl-2,1,3-benzoxadiazole
- Product Name4-Chloro-7-chlorosulfonyl-2,1,3-benzoxadiazole
- CAS142246-48-8
- MFC6H2Cl2N2O3S
- MW253.06
- EINECS
- MOL File142246-48-8.mol
Chemical Properties
| Melting point | 85.0 to 89.0 °C |
| Boiling point | 361.7±45.0 °C(Predicted) |
| Density | 1.789±0.06 g/cm3(Predicted) |
| storage temp. | room temp |
| pka | -6.24±0.50(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| λmax | 324 nm |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C6H2Cl2N2O3S/c7-3-1-2-4(14(8,11)12)6-5(3)9-13-10-6/h1-2H |
| InChIKey | BPPRLMZEVZSIIJ-UHFFFAOYSA-N |
| SMILES | Clc1ccc(c2nonc12)S(Cl)(=O)=O |
| CAS DataBase Reference | 142246-48-8 |
Safety Information
| Hazard Codes | Xi,C |
| Risk Statements | 34 |
| Safety Statements | 36/37/39-45-26 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 2934999090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |