THORIN
- Product NameTHORIN
- CAS3688-92-4
- MFC16H14AsN2NaO10S2
- MW556.32
- EINECS222-993-1
- MOL File3688-92-4.mol
Chemical Properties
| Melting point | >300°C |
| bulk density | 700kg/m3 |
| storage temp. | Store at +5°C to +30°C. |
| form | powder to crystal |
| pka | pK1:3.7;pK2:8.3;pK3:11.8 (25°C) |
| color | Orange to Brown to Dark red |
| PH | 6.1 (10g/l, H2O, 20℃) |
| Water Solubility | Soluble in water. |
| λmax | 480-490 nm (propan-2-ol) |
| InChIKey | DCSRPHQBFSYJNN-BUFQOAPZSA-L |
| SMILES | [As](=O)([O-])([O-])c1c(cccc1)N\N=C2/c3c(cc(cc3)[S](=O)(=O)O)C=C(C/2=O)[S](=O)(=O)O.[Na+].[Na+] |
| CAS DataBase Reference | 3688-92-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,N |
| Risk Statements | 23/25-50/53 |
| Safety Statements | 20/21-28-45-60-61 |
| RIDADR | UN 3465 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29270000 |
| Storage Class | 6.1A - Combustible, acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |
