Tris(4-formylphenyl)amine
- Product NameTris(4-formylphenyl)amine
- CAS119001-43-3
- MFC21H15NO3
- MW329.35
- EINECS
- MOL File119001-43-3.mol
Chemical Properties
| Melting point | 244-248 °C |
| Boiling point | 551.1±45.0 °C(Predicted) |
| Density | 1.288±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Chloroform |
| form | powder to crystal |
| pka | -10.76±0.50(Predicted) |
| color | Light yellow to Yellow to Green |
| InChI | InChI=1S/C21H15NO3/c23-13-16-1-7-19(8-2-16)22(20-9-3-17(14-24)4-10-20)21-11-5-18(15-25)6-12-21/h1-15H |
| InChIKey | YOXHQRNDWBRUOL-UHFFFAOYSA-N |
| SMILES | N(C1=CC=C(C=C1)C=O)(C1=CC=C(C=C1)C=O)C1=CC=C(C=C1)C=O |
| CAS DataBase Reference | 119001-43-3 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HS Code | 29223990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 Skin Sens. 1 |
