2-Fluorenecarboxaldehyde
- Product Name2-Fluorenecarboxaldehyde
- CAS30084-90-3
- MFC14H10O
- MW194.23
- EINECS250-035-2
- MOL File30084-90-3.mol
Chemical Properties
| Melting point | 83-85 °C(lit.) |
| Boiling point | 290.68°C (rough estimate) |
| Density | 1.0550 (rough estimate) |
| refractive index | 1.5920 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Orange to Green |
| Sensitive | Air & Light Sensitive |
| BRN | 2255852 |
| InChI | 1S/C14H10O/c15-9-10-5-6-14-12(7-10)8-11-3-1-2-4-13(11)14/h1-7,9H,8H2 |
| InChIKey | MNQGEQSXFDKAPY-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1ccc-2c(Cc3ccccc-23)c1 |
| CAS DataBase Reference | 30084-90-3(CAS DataBase Reference) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | LL5917000 |
| F | 9-23 |
| HS Code | 29122990 |
| Storage Class | 11 - Combustible Solids |
