(3-oxo-indan-1-yl)-acetic acid
- Product Name(3-oxo-indan-1-yl)-acetic acid
- CAS25173-12-0
- MFC11H10O3
- MW190.2
- EINECS
- MOL File25173-12-0.mol
Chemical Properties
| Melting point | 155℃ |
| Boiling point | 380.5±21.0 °C(Predicted) |
| Density | 1.291±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C |
| pka | 4.37±0.10(Predicted) |
| form | powder |
| InChI | 1S/C11H10O3/c12-10-5-7(6-11(13)14)8-3-1-2-4-9(8)10/h1-4,7H,5-6H2,(H,13,14) |
| InChIKey | SOHVBHRLBOMHIS-UHFFFAOYSA-N |
| SMILES | OC(CC1CC(C2=CC=CC=C21)=O)=O |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | mouse,LD50,intraperitoneal,1500mg/kg (1500mg/kg),Indian Journal of Physiology and Pharmacology. Vol. 24, Pg. 310, 1980. |