4-(N,N-Dimethylaminocarbonyl)phenylboronic acid
- Product Name4-(N,N-Dimethylaminocarbonyl)phenylboronic acid
- CAS405520-68-5
- MFC9H12BNO3
- MW193.01
- EINECS
- MOL File405520-68-5.mol
Chemical Properties
| Melting point | 141-145 °C |
| Boiling point | 407.4±47.0 °C(Predicted) |
| Density | 1.20±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 7.76±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C9H12BNO3/c1-11(2)9(12)7-3-5-8(6-4-7)10(13)14/h3-6,13-14H,1-2H3 |
| InChIKey | QJYYVSIRDJVQJW-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C(N(C)C)=O)C=C1)(O)O |
| CAS DataBase Reference | 405520-68-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 1 |
| Hazard Note | Irritant/Keep Cold |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |