1-Bromo-2,4-dinitrobenzene
- Product Name1-Bromo-2,4-dinitrobenzene
- CAS584-48-5
- MFC6H3BrN2O4
- MW247
- EINECS209-539-8
- MOL File584-48-5.mol
Chemical Properties
| Melting point | 71-73 °C(lit.) |
| Boiling point | 288℃ |
| Density | 1.910 |
| refractive index | 1.6100 (estimate) |
| Flash point | 128℃ |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| form | powder to crystal |
| color | White to Yellow to Green |
| Water Solubility | Soluble in water (partly miscible). |
| InChI | InChI=1S/C6H3BrN2O4/c7-5-2-1-4(8(10)11)3-6(5)9(12)13/h1-3H |
| InChIKey | PBOPJYORIDJAFE-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 584-48-5(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene, 1-bromo-2,4-dinitro- (584-48-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36-36/37 |
| RIDADR | UN3459 |
| WGK Germany | 3 |
| RTECS | CY9021500 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |