| Boiling point |
291-293 °C |
| Density |
0.865 g/mL at 20 °C(lit.) |
| refractive index |
n20/D 1.445 |
| Flash point |
110°C |
| storage temp. |
Storage temp. 2-8°C |
| form |
clear liquid |
| color |
Colorless to Light yellow to Light orange |
| Specific Gravity |
0.865 |
| Hydrolytic Sensitivity |
8: reacts rapidly with moisture, water, protic solvents |
| BRN |
5240407 |
| InChI |
InChI=1S/C14H31ClSi/c1-16(2)14-12-10-8-6-4-3-5-7-9-11-13-15/h16H,3-14H2,1-2H3 |
| InChIKey |
WEJOUFHBSYHICH-UHFFFAOYSA-N |
| SMILES |
[SiH](CCCCCCCCCCCCCl)(C)C |
| CAS DataBase Reference |
66604-31-7 |