Chloro(dodecyl)dimethylsilane
- Product NameChloro(dodecyl)dimethylsilane
- CAS66604-31-7
- MFC14H31ClSi
- MW262.93
- EINECS266-421-9
- MOL File66604-31-7.mol
Chemical Properties
| Boiling point | 291-293 °C |
| Density | 0.865 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point | 110°C |
| storage temp. | Storage temp. 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 0.865 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 5240407 |
| InChI | InChI=1S/C14H31ClSi/c1-16(2)14-12-10-8-6-4-3-5-7-9-11-13-15/h16H,3-14H2,1-2H3 |
| InChIKey | WEJOUFHBSYHICH-UHFFFAOYSA-N |
| SMILES | [SiH](CCCCCCCCCCCCCl)(C)C |
| CAS DataBase Reference | 66604-31-7 |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2987 8/PG 2 |
| WGK Germany | 1 |
| F | 10-21 |
| TSCA | No |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29319000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
