2-Phenylethyl methacrylate
- Product Name2-Phenylethyl methacrylate
- CAS3683-12-3
- MFC12H14O2
- MW190.24
- EINECS222-969-0
- MOL File3683-12-3.mol
Chemical Properties
| Melting point | 119~120℃/11mm |
| Boiling point | 119-120°C 11mm |
| Density | 0,976 g/cm3 |
| refractive index | 1.4970 (estimate) |
| Flash point | 158℃ |
| form | clear liquid |
| color | Colorless to Light yellow |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | InChI=1S/C12H14O2/c1-10(2)12(13)14-9-8-11-6-4-3-5-7-11/h3-7H,1,8-9H2,2H3 |
| InChIKey | ILZXXGLGJZQLTR-UHFFFAOYSA-N |
| SMILES | C(OCCC1=CC=CC=C1)(=O)C(C)=C |
| LogP | 3.032 (est) |
| CAS DataBase Reference | 3683-12-3 |
| EPA Substance Registry System | 2-Phenylethyl methacrylate (3683-12-3) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| TSCA | TSCA listed |
| HS Code | 2916.14.2050 |
| Toxicity | rabbit,LDLo,skin,5gm/kg (5000mg/kg),Food and Chemical Toxicology. Vol. 30, Pg. 105S, 1992. |
