| Melting point |
80°C |
| Boiling point |
287-290 °C(lit.) |
| Density |
0.97 g/mL at 25 °C(lit.) |
| vapor pressure |
0.133Pa at 25℃ |
| FEMA |
2061 | ALPHA-AMYLCINNAMALDEHYDE |
| refractive index |
n20/D 1.557(lit.) |
| Flash point |
>230 °F |
| storage temp. |
2-8°C |
| solubility |
Soluble in alcohol and perfume materials. Insoluble in water. |
| form |
liquid |
| color |
Pale-yellow oil or liquid |
| Odor |
floral jasmine odor |
| biological source |
synthetic |
| Odor Type |
floral |
| Water Solubility |
181.69mg/L at 25℃ |
| JECFA Number |
685 |
| Henry's Law Constant |
1.3×100 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application |
flavors and fragrances |
| Cosmetics Ingredients Functions |
PERFUMING |
| InChI |
1S/C14H18O/c1-2-3-5-10-14(12-15)11-13-8-6-4-7-9-13/h4,6-9,11-12H,2-3,5,10H2,1H3/b14-11+ |
| InChIKey |
HMKKIXGYKWDQSV-SDNWHVSQSA-N |
| SMILES |
[H]C(/C(CCCCC)=C/C1=CC=CC=C1)=O |
| LogP |
2.498 at 25℃ |
| CAS DataBase Reference |
122-40-7(CAS DataBase Reference) |
| NIST Chemistry Reference |
Heptanal, 2-(phenylmethylene)-(122-40-7) |
| EPA Substance Registry System |
2-(Phenylmethylene)heptanal (122-40-7) |
