| Melting point |
112-113 °C(lit.) |
| Boiling point |
364.51°C (rough estimate) |
| Density |
1.2446 (rough estimate) |
| refractive index |
1.4960 (estimate) |
| storage temp. |
Sealed in dry,Store in freezer, under -20°C |
| solubility |
almost transparency in Methanol |
| form |
powder to crystal |
| pka |
4.00±0.10(Predicted) |
| color |
White to Almost white |
| BRN |
6847292 |
| Major Application |
peptide synthesis |
| InChI |
1S/C11H13NO4/c1-8(10(13)14)12-11(15)16-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,12,15)(H,13,14) |
| InChIKey |
TYRGLVWXHJRKMT-UHFFFAOYSA-N |
| SMILES |
CC(NC(=O)OCc1ccccc1)C(O)=O |
| CAS DataBase Reference |
4132-86-9(CAS DataBase Reference) |
