| Melting point |
194-196°C |
| Density |
1.54±0.1 g/cm3(Predicted) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Toltrazuril is soluble in organic solvents such as ethanol, DMSO, and dimethyl formamide (DMF), which should be purged with an inert gas. The solubility of toltrazuril in ethanol is approximately 1 mg/ml and approximately 25 mg/ml in DMSO and DMF. |
| pka |
6.47±0.20(Predicted) |
| form |
Solid |
| color |
White to off-white |
| Major Application |
forensics and toxicology
pharmaceutical (small molecule) |
| InChI |
InChI=1S/C18H14F3N3O4S/c1-10-9-11(24-16(26)22-15(25)23(2)17(24)27)3-8-14(10)28-12-4-6-13(7-5-12)29-18(19,20)21/h3-9H,1-2H3,(H,22,25,26) |
| InChIKey |
OCINXEZVIIVXFU-UHFFFAOYSA-N |
| SMILES |
N1(C)C(=O)NC(=O)N(C2=CC=C(OC3=CC=C(SC(F)(F)F)C=C3)C(C)=C2)C1=O |
| CAS DataBase Reference |
69004-03-1(CAS DataBase Reference) |
