| Melting point |
126-1280C |
| Boiling point |
485.6±45.0 °C(Predicted) |
| Density |
1.419±0.06 g/cm3(Predicted) |
| storage temp. |
2-8°C |
| solubility |
DMSO: ≥15mg/mL |
| pka |
4.78±0.38(Predicted) |
| form |
powder |
| color |
yellow |
| Stability |
Stable for 1 year from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20°C for up to 2 months. |
| Major Application |
pharmaceutical (small molecule) |
| InChI |
InChI=1S/C14H11NO5/c1-8-2-4-9(5-3-8)13(17)10-6-11(15(19)20)14(18)12(16)7-10/h2-7,16,18H,1H3 |
| InChIKey |
MIQPIUSUKVNLNT-UHFFFAOYSA-N |
| SMILES |
C(C1=CC([N+]([O-])=O)=C(O)C(O)=C1)(C1=CC=C(C)C=C1)=O |
| CAS DataBase Reference |
134308-13-7(CAS DataBase Reference) |
