| Melting point |
141-143 °C(lit.) |
| Boiling point |
145.3℃[at 101 325 Pa] |
| Density |
1.20 |
| vapor pressure |
0Pa at 25℃ |
| storage temp. |
Store below +30°C. |
| solubility |
acetonitrile: 0.1 g/mL, clear, colorless |
| form |
Crystalline Powder |
| color |
White to cream |
| Odor |
Amine like |
| Appearance |
White to almost white powder, crystals, or flakes. |
| Water Solubility |
Soluble in water and methanol. Insoluble in benzene. |
| Sensitive |
Light Sensitive & Hygroscopic |
| λmax |
λ: 290 nm Amax: 0.1
λ: 300 nm Amax: 0.05
λ: 320 nm Amax: 0.02
λ: 500 nm Amax: 0.02 |
| BRN |
3916152 |
| Exposure limits |
ACGIH: TWA 0.01 ppm |
| Stability |
Stable. Incompatible with strong oxidizing agents. Light-sensitive. |
| InChI |
1S/C16H36N.HI/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey |
DPKBAXPHAYBPRL-UHFFFAOYSA-M |
| SMILES |
[I-].CCCC[N+](CCCC)(CCCC)CCCC |
| LogP |
0.869 at 25℃ |
| CAS DataBase Reference |
311-28-4(CAS DataBase Reference) |
| EPA Substance Registry System |
Tetrabutylammonium iodide (311-28-4) |
