| Boiling point |
120-125 °C(Press: 0.1 Torr) |
| Density |
0.817 g/mL at 20 °C(lit.) |
| vapor pressure |
0.001Pa at 20℃ |
| refractive index |
n20/D 1.451 |
| Flash point |
163°C |
| form |
clear liquid |
| pka |
9.32±0.50(Predicted) |
| color |
Colorless to Light orange to Yellow |
| BRN |
2087270 |
| Henry's Law Constant |
7.0×10-4 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| InChI |
InChI=1S/C24H51N/c1-7-13-16-22(10-4)19-25(20-23(11-5)17-14-8-2)21-24(12-6)18-15-9-3/h22-24H,7-21H2,1-6H3 |
| InChIKey |
BZUDVELGTZDOIG-UHFFFAOYSA-N |
| SMILES |
C(N(CC(CC)CCCC)CC(CC)CCCC)C(CC)CCCC |
| LogP |
10.13 at 25℃ |
| CAS DataBase Reference |
1860-26-0(CAS DataBase Reference) |
| EPA Substance Registry System |
1-Hexanamine, 2-ethyl-N,N-bis(2-ethylhexyl)- (1860-26-0) |