| Melting point |
115° |
| Boiling point |
115 °C10 mm Hg(lit.) |
| Density |
0.849 g/mL at 25 °C(lit.) |
| FEMA |
3423 | 2-UNDECENAL |
| refractive index |
n20/D 1.457(lit.) |
| Flash point |
>230 °F |
| form |
clear liquid |
| color |
Colorless to Light yellow |
| Odor |
at 1.00 % in dipropylene glycol. fresh fruity citrus orange peel |
| Odor Type |
fruity |
| biological source |
synthetic |
| BRN |
1762239 |
| Major Application |
flavors and fragrances |
| Cosmetics Ingredients Functions |
PERFUMING |
| InChI |
1S/C11H20O/c1-2-3-4-5-6-7-8-9-10-11-12/h9-11H,2-8H2,1H3/b10-9+ |
| InChIKey |
PANBRUWVURLWGY-MDZDMXLPSA-N |
| SMILES |
[H]C(=O)\C([H])=C(/[H])CCCCCCCC |
| LogP |
4.23 |
| CAS DataBase Reference |
53448-07-0(CAS DataBase Reference) |
| NIST Chemistry Reference |
2-Undecenal, e-(53448-07-0) |
