| Melting point |
>300 °C (lit.) |
| Density |
1.528[at 20℃] |
| storage temp. |
under inert gas (nitrogen or Argon) at 2-8°C |
| solubility |
Aqueous Acid (Slightly), Methanol (Slightly), Water (Slightly) |
| form |
Solid |
| color |
White to Off-White |
| Water Solubility |
479g/L at 20℃ |
| Hydrolytic Sensitivity |
0: forms stable aqueous solutions |
| Stability |
May be unstable; may spontaneously polymerize. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C3H4O2.Na/c1-2-3(4)5;/h2H,1H2,(H,4,5);/q;+1/p-1 |
| InChIKey |
NNMHYFLPFNGQFZ-UHFFFAOYSA-M |
| SMILES |
C([O-])(=O)C=C.[Na+] |
| LogP |
0.46 at 25℃ |
| CAS DataBase Reference |
7446-81-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Sodium acrylate (7446-81-3) |
