| Melting point |
208-212° |
| Boiling point |
476.7±40.0 °C(Predicted) |
| Density |
1.189±0.06 g/cm3(Predicted) |
| storage temp. |
under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility |
Soluble in DMSO (up to 50 mg/ml). |
| form |
solid |
| pka |
16.03±0.50(Predicted) |
| color |
White |
| Merck |
14,8315 |
| Stability |
Stable for 2 years from date of purchase as supplied. Solutions in DMSO may be stored at -20° for up to 3 months. |
| InChI |
InChI=1S/C17H19FN2O2/c1-12(17(19)21)20-10-13-5-7-16(8-6-13)22-11-14-3-2-4-15(18)9-14/h2-9,12,20H,10-11H2,1H3,(H2,19,21)/t12-/m0/s1 |
| InChIKey |
NEMGRZFTLSKBAP-LBPRGKRZSA-N |
| SMILES |
C(N)(=O)[C@@H](NCC1=CC=C(OCC2=CC=CC(F)=C2)C=C1)C |
