| Boiling point |
140°C/1013hPa |
| Density |
1.438 g/mL at 25 °C |
| vapor pressure |
0-0Pa at 25℃ |
| refractive index |
n20/D 1.449 |
| storage temp. |
Store below +30°C. |
| pka |
-0.46±0.50(Predicted) |
| form |
viscous liquid |
| PH |
1 (20°C in H2O, saturated aqueous solution) |
| BRN |
1727687 |
| Stability |
Stable. Hygroscopic. Incompatible with strong oxidizing agents. |
| InChI |
1S/C4H6O7S/c5-3(6)1-2(4(7)8)12(9,10)11/h2H,1H2,(H,5,6)(H,7,8)(H,9,10,11) |
| InChIKey |
ULUAUXLGCMPNKK-UHFFFAOYSA-N |
| SMILES |
OC(=O)CC(C(O)=O)S(O)(=O)=O |
| LogP |
-0.463 at 25℃ and pH7 |
| EPA Substance Registry System |
Sulfosuccinic acid (5138-18-1) |