| Melting point |
300 °C |
| Density |
0.9 g/cm3 |
| storage temp. |
Sealed in dry,Room Temperature |
| pka |
0.6[at 20 ℃] |
| form |
Powder or Granular Powder |
| color |
White to off-white |
| Water Solubility |
Soluble in water, ethanol, methanol, acetone. |
| Sensitive |
Hygroscopic |
| Merck |
14,9627 |
| BRN |
3572664 |
| InChI |
InChI=1S/C2HCl3O2.Na/c3-2(4,5)1(6)7;/h(H,6,7);/q;+1/p-1 |
| InChIKey |
SAQSTQBVENFSKT-UHFFFAOYSA-M |
| SMILES |
C(Cl)(Cl)(Cl)C([O-])=O.[Na+] |
| LogP |
-2.67 at 25℃ |
| CAS DataBase Reference |
650-51-1(CAS DataBase Reference) |
| EPA Substance Registry System |
Sodium trichloroacetate (650-51-1) |