| Melting point |
182-183 °C (dec.)(lit.) |
| Boiling point |
524.7±50.0 °C(Predicted) |
| Density |
1.1342 (rough estimate) |
| refractive index |
111 ° (C=0.8, 0.04mol Ethanolic HCl) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Soluble in DMSO (up to 20 mg/ml). |
| pka |
2.22±0.10(Predicted) |
| form |
White to off-white solid. |
| color |
White or off-white |
| optical activity |
[α]25/D +115°, c = 0.8 in 0.04 M ethanolic HCl |
| BRN |
2339626 |
| Stability |
Stable for 2 years from date of purchase as supplied. Solutions in DMSO may be stored at -20°C for up to 1 week. |
| InChI |
InChI=1S/C22H21NO2S/c23-20(21(24)25)16-26-22(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20H,16,23H2,(H,24,25)/t20-/m0/s1 |
| InChIKey |
DLMYFMLKORXJPO-FQEVSTJZSA-N |
| SMILES |
C(O)(=O)[C@H](CSC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)N |
| CAS DataBase Reference |
2799-07-7(CAS DataBase Reference) |
