| Melting point |
174-176°C |
| alpha |
D25 -36.5° (c = 1 in water); D20 -38° (c = 1 in water) |
| Boiling point |
387.12°C (rough estimate) |
| Density |
1.4287 (rough estimate) |
| refractive index |
-36 ° (C=1, H2O) |
| storage temp. |
2-8°C |
| solubility |
Freely soluble in water, slightly soluble in ethanol (96 per cent), slightly soluble or very slightly soluble in methylene chloride. It shows polymorphism (5.9). |
| form |
White solid |
| pka |
12.95±0.70(Predicted) |
| color |
White |
| Water Solubility |
>=10 g/100 mL at 19 ºC |
| Merck |
14,8198 |
| BCS Class |
3 |
| Stability |
Stable for 1 year from date of purchase as supplied. Solutions in DMSO or distilled water may be stored at -20°C for up to 3 months. |
| Major Application |
pharmaceutical (small molecule) |
| InChI |
1S/C8H12N4O5/c9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8/h2-5,8,13-15H,1H2,(H2,9,16)/t3-,4-,5-,8-/m1/s1 |
| InChIKey |
IWUCXVSUMQZMFG-AFCXAGJDSA-N |
| SMILES |
NC(=O)c1ncn(n1)[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O |
| LogP |
-2.260 (est) |
| CAS DataBase Reference |
36791-04-5 |
| EPA Substance Registry System |
Ribavirin (36791-04-5) |
