| Melting point |
309°C (decompose) |
| Boiling point |
372.4°C (rough estimate) |
| Density |
1.2497 (rough estimate) |
| refractive index |
1.4200 (estimate) |
| storage temp. |
Store at room temperature. |
| solubility |
Practically insoluble in water, benzene; freely soluble in ethanol |
| form |
Crystalline Powder |
| Colour Index |
43800 |
| pka |
6.98(at 25℃) |
| color |
Red-brown to brownish-red |
| PH Range |
6.8(YELLOW)--8.2(RED) |
| PH |
5.0-6.8, yellow to pink |
| Water Solubility |
Soluble in alcohol, sodium hydroxide, potassium hydroxide and strong acids. Insoluble in water. |
| λmax |
534.6nm, 479.5nm, 482nm |
| ε(extinction coefficient) |
≥11000 at 264-270nm in ethanol
≥50000 at 478-486nm in ethanol |
| Merck |
14,881 |
| BRN |
2055205 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
electrorheological materials, films patterning, antireflective coatings, thermochromic materials, photoresists, film patterning, recording materials, lithium battery, semiconductors, printing materials, inks, corrosion inhibitors, adhesives, drugs, detecting viable cells, treatment of Alzheimer’s disease |
| InChI |
1S/C19H14O3/c20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15/h1-12,20-21H |
| InChIKey |
FYEHYMARPSSOBO-UHFFFAOYSA-N |
| SMILES |
O=C(C=C1)C=CC1=C(C2=CC=C(O)C=C2)C3=CC=C(O)C=C3 |
| CAS DataBase Reference |
603-45-2 |
| EPA Substance Registry System |
2,5-Cyclohexadien-1-one, 4-[bis(4-hydroxyphenyl)methylene]- (603-45-2) |
