| Melting point |
173-175 °C(lit.) |
| alpha |
-172 º (c=1, EtOH) |
| Boiling point |
462.75°C (rough estimate) |
| Density |
1.1294 (rough estimate) |
| bulk density |
110-140kg/m3 |
| vapor pressure |
0Pa at 25℃ |
| refractive index |
1.6250 (estimate) |
| Flash point |
>110°C (>230°F) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
H2O: soluble |
| pka |
8.52(at 25℃) |
| form |
Crystalline Powder |
| color |
White |
| PH |
9.0 (0.5g/l, H2O, 20℃) |
| PH Range |
Blue I uorescence (3.0) to weak violet I uorescence (5.0);Weak violet I uorescence (9.5) to nonI uorescence (10.0) |
| optical activity |
[α]25/D 165°, c = 2 in ethanol |
| Odor Type |
odorless |
| Water Solubility |
slightly soluble |
| Hydrolytic Sensitivity |
2: reacts with aqueous acid |
| Sensitive |
Light Sensitive |
| Merck |
14,8061 |
| BRN |
91867 |
| Major Application |
Bird repellents, sunscreen, antimalarial agent, antiviral agent, antitumor agent, drug-coated coronaryagent, antiparasitic agent, treatment of epilepsy, skeletal muscle spasm, drug-coated coronary stent system |
| Cosmetics Ingredients Functions |
HAIR CONDITIONING
DENATURANT
FRAGRANCE |
| InChI |
1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14-,19-,20+/m0/s1 |
| InChIKey |
LOUPRKONTZGTKE-WZBLMQSHSA-N |
| SMILES |
COc1ccc2nccc([C@@H](O)[C@@H]3C[C@@H]4CCN3C[C@@H]4C=C)c2c1 |
| LogP |
3.17 at 25℃ |
| CAS DataBase Reference |
130-95-0(CAS DataBase Reference) |
| NIST Chemistry Reference |
Quinine(130-95-0) |
| EPA Substance Registry System |
Quinine (130-95-0) |
