| Melting point |
185-187°C dec. |
| alpha |
D20 +17.0° (c = 2.0 in 6M HCl) |
| Boiling point |
324.36°C (rough estimate) |
| Density |
1.6649 (rough estimate) |
| refractive index |
1.6190 (estimate) |
| storage temp. |
2-8°C |
| solubility |
NH4OH 1 M: 20 mg/mL, clear, colorless |
| pka |
2.12±0.10(Predicted) |
| form |
powder |
| color |
white to off-white |
| Water Solubility |
Soluble in ethanol, water. Insoluble in organic solvents. |
| Merck |
13,8177 |
| BRN |
1078734 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1/C5H7N3O5/c6-2(3(9)10)1-8-4(11)7-5(12)13-8/h2H,1,6H2,(H,9,10)(H,7,11,12)/t2-/s3 |
| InChIKey |
ASNFTDCKZKHJSW-NVFNTWQMNA-N |
| SMILES |
N1(C[C@H](N)C(=O)O)OC(=O)NC1=O |&1:2,r| |
