| Melting point |
158-160 °C (dec.)(lit.) |
| Density |
1.3395 (rough estimate) |
| refractive index |
1.6930 (estimate) |
| storage temp. |
-20°C |
| solubility |
H2O: 0.2 g/mL at 20 °C, clear, deep orange |
| form |
Crystalline Powder |
| color |
Dark yellow to brown or khaki |
| Water Solubility |
soluble in water (approximately 200 mg/ml). |
| Sensitive |
Light Sensitive |
| Merck |
14,6109 |
| BRN |
3898869 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C13H11N2.CH4O4S/c1-15-12-8-4-2-6-10(12)14-11-7-3-5-9-13(11)15;1-5-6(2,3)4/h2-9H,1H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey |
RXGJTUSBYWCRBK-UHFFFAOYSA-M |
| SMILES |
C12C=CC=CC1=NC1=CC=CC=C1[N+]=2C.S([O-])(=O)(=O)OC |
| CAS DataBase Reference |
299-11-6(CAS DataBase Reference) |
| EPA Substance Registry System |
Phenazinium, 5-methyl-, methyl sulfate (299-11-6) |
