| Melting point |
154 °C |
| Boiling point |
435.17°C (rough estimate) |
| Density |
1.2278 (rough estimate) |
| refractive index |
1.5100 (estimate) |
| storage temp. |
2-8°C |
| solubility |
Soluble in DMSO |
| form |
solid |
| pka |
4.3(at 25℃) |
| color |
Crystals from methanol |
| Water Solubility |
4mg/L(37 ºC) |
| Merck |
14,6924 |
| BCS Class |
2 |
| Stability |
Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20°C for up to 3 months. |
| Major Application |
pharmaceutical (small molecule) |
| InChI |
1S/C18H15NO3/c20-16(21)12-11-15-19-17(13-7-3-1-4-8-13)18(22-15)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,20,21) |
| InChIKey |
OFPXSFXSNFPTHF-UHFFFAOYSA-N |
| SMILES |
OC(=O)CCc1nc(-c2ccccc2)c(o1)-c3ccccc3 |
| CAS DataBase Reference |
21256-18-8(CAS DataBase Reference) |
| EPA Substance Registry System |
2-Oxazolepropanoic acid, 4,5-diphenyl- (21256-18-8) |
