| Melting point |
21.5-23.5 °C(lit.) |
| Boiling point |
285-290 °C(lit.) |
| Density |
0.936 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.5044(lit.) |
| Flash point |
>230 °F |
| storage temp. |
2-8°C |
| form |
Liquid |
| color |
Clear colorless to slightly yellow |
| Water Solubility |
Soluble in hot ethanol, acetone, toluene and other common organic solvents. Insoluble in water. |
| BRN |
1868534 |
| InChI |
InChI=1S/C14H20O/c1-2-3-4-5-9-12-14(15)13-10-7-6-8-11-13/h6-8,10-11H,2-5,9,12H2,1H3 |
| InChIKey |
UDEVCZRUNOLVLU-UHFFFAOYSA-N |
| SMILES |
C(C1=CC=CC=C1)(=O)CCCCCCC |
| CAS DataBase Reference |
1674-37-9(CAS DataBase Reference) |
| EPA Substance Registry System |
Octanophenone (1674-37-9) |
