| Melting point |
-27.17°C (estimate) |
| Boiling point |
65-66 °C/13 mmHg |
| Density |
0.818 g/mL at 20 °C(lit.) |
| vapor pressure |
2.207hPa at 24℃ |
| refractive index |
n20/D 1.485 |
| FEMA |
3539 | 3,7-DIMETHYL-1,3,6-OCTATRIENE |
| Flash point |
38 °C |
| storage temp. |
2-8°C |
| solubility |
Chloroform: Slightly Soluble; Methanol: Slightly Soluble |
| form |
An oil |
| Specific Gravity |
0.80 |
| color |
Colorless to light yellow |
| Odor |
at 100.00 %. citrus tropical green terpene woody green |
| Odor Type |
floral |
| biological source |
synthetic |
| Water Solubility |
14.5mg/L at 24℃ |
| JECFA Number |
1338 |
| BRN |
1736172 |
| Henry's Law Constant |
4.0×10-4 mol/(m3Pa) at 25℃, Copolovici and Niinemets (2005) |
| Major Application |
flavors and fragrances |
| Cosmetics Ingredients Functions |
PERFUMING |
| InChI |
1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7-8H,1,6H2,2-4H3 |
| InChIKey |
IHPKGUQCSIINRJ-UHFFFAOYSA-N |
| SMILES |
[H]C(CC([H])=C(C)C=C)=C(C)C |
| LogP |
5.4 at 25℃ |
| EPA Substance Registry System |
1,3,6-Octatriene, 3,7-dimethyl- (13877-91-3) |
