| Melting point |
200-2050C |
| RTECS |
QD2275000 |
| storage temp. |
2-8°C |
| solubility |
ethanol: 3.3 mg/mL stable for several months refrigerated if protected from light. |
| form |
powder |
| color |
white to off-white |
| Water Solubility |
Soluble in water (73 mg/ml), ethanol (3.3 mg/ml), methanol (50 mg/ml) and dimethyl sulfoxide (73 mg/ml). Insoluble in ether |
| Stability |
Stable for 1 year from date of purchase as supplied. Solutions in DMSO or distilled water may be stored at -20°C for up to 2 months. |
| InChI |
InChI=1/C19H21NO4.ClH/c1-2-8-20-9-7-18-15-11-3-4-12(21)16(15)24-17(18)13(22)5-6-19(18,23)14(20)10-11;/h2-4,14,17,21,23H,1,5-10H2;1H/t14-,17+,18+,19-;/s3 |
| InChIKey |
RGPDIGOSVORSAK-ASLVLMPBNA-N |
| SMILES |
[C@@]123CCN(CC=C)[C@@H]4CC5=CC=C(O)C(O[C@H]1C(CC[C@]24O)=O)=C35.Cl |&1:0,7,16,20,r| |
| CAS DataBase Reference |
357-08-4(CAS DataBase Reference) |
