| Melting point |
130°C (dec.) |
| Boiling point |
595.4±50.0 °C(Predicted) |
| Density |
1.50±0.1 g/cm3(Predicted) |
| storage temp. |
Inert atmosphere,Store in freezer, under -20°C |
| solubility |
Methanol (Slightly), Water (Slightly) |
| pka |
12.04±0.70(Predicted) |
| form |
powder |
| color |
White to Off-White |
| biological source |
animal (crustaceans) |
| Water Solubility |
water: 50mg/mL, clear, colorless to faintly yellow |
| BRN |
1346524 |
| Stability |
Hygroscopic |
| InChI |
1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5+,6-,7-,8+/m1/s1 |
| InChIKey |
MBLBDJOUHNCFQT-YWIQKCBGSA-N |
| SMILES |
CC(=O)N[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| CAS DataBase Reference |
7772-94-3(CAS DataBase Reference) |
| EPA Substance Registry System |
.beta.-D-Mannopyranose, 2-(acetylamino)-2-deoxy- (7772-94-3) |