| Melting point |
2.9 °C (37.2 °F; 276.0 K) |
| Boiling point |
156 to 157 °C (313 to 315 °F; 429 to 430 K) at 0.7 mmHg (93 Pa) |
| Density |
1.23 g/cm3 |
| vapor pressure |
7.95 at 25 °C (gas saturation method-GC, Kim et al., 1984) |
| refractive index |
nD25 1.4985 |
| Flash point |
163 °C; 325 °F; 436 K (greater than) |
| storage temp. |
APPROX 4°C |
| solubility |
Slightly soluble in water, miscible with acetone, with cyclohexane, with ethanol (96 per cent) and with vegetable oils. |
| form |
Clear liquid |
| color |
colorless |
| Specific Gravity |
1.23 (25℃) |
| Odor |
Characteristic odor |
| biological source |
human |
| Water Solubility |
0.0145 g/100 mL |
| Specific Heat Capacity |
Cp(gas): 0.1 J/(g·K), at 25℃ |
| Specific Activity |
15-21nmol/min·mg |
| Henry's Law Constant |
(x 10-9 atmm3/mol):
4.89 at 25 °C (wetted-wall column, Fendinger and Glotfelty, 1990) |
| Exposure limits |
ACGIH:TLV-TWA 1 mg/m3,Inhalable fraction and vapor
OSHA:PEL-TWA 15 mg/m3
NIOSH:REL-TWA 10 mg/m3 |
| Stability |
Stable. Incompatible with oxidizing agents, metals. |
| Major Application |
agriculture |
| InChI |
1S/C10H19O6PS2/c1-5-15-9(11)7-8(10(12)16-6-2)19-17(18,13-3)14-4/h8H,5-7H2,1-4H3 |
| InChIKey |
JXSJBGJIGXNWCI-UHFFFAOYSA-N |
| SMILES |
CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC |
| LogP |
2.360 |
| CAS DataBase Reference |
121-75-5(CAS DataBase Reference) |
| IARC |
2A (Vol. 30, Sup 7, 112) 2017 |
| NIST Chemistry Reference |
Malathion(121-75-5) |
| EPA Substance Registry System |
Malathion (121-75-5) |
