| Boiling point |
201 °C (lit.) |
| Density |
0.951 g/mL at 25 °C (lit.) |
| vapor pressure |
46-84Pa at 20℃ |
| refractive index |
n20/D 1.446(lit.) |
| Flash point |
166 °F |
| storage temp. |
Storage temp. 2-8°C |
| solubility |
water: soluble0.3g/L at 30°C |
| form |
liquid |
| Odor |
at 100.00 %. fruity tropical banana mango pineapple honey |
| Appearance |
Colorless to light yellow Liquid |
| Odor Type |
fruity |
| Water Solubility |
water: soluble 0.3g/L at30°C |
| InChI |
InChI=1S/C9H16O2/c1-11-9(10)7-8-5-3-2-4-6-8/h8H,2-7H2,1H3 |
| InChIKey |
IMXBRVLCKXGWSS-UHFFFAOYSA-N |
| SMILES |
C1(CC(OC)=O)CCCCC1 |
| LogP |
1.32 at 20℃ and pH4.7-5.5 |
| NIST Chemistry Reference |
Methylcyclohexylacetate(14352-61-5) |
| EPA Substance Registry System |
Cyclohexaneacetic acid, methyl ester (14352-61-5) |
