Melting point |
224-228 °C |
Boiling point |
335.48°C (rough estimate) |
Density |
1.3764 (rough estimate) |
refractive index |
1.6180 (estimate) |
storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
solubility |
Water (Slightly, Heated, Sonicated) |
form |
Pink to brown powder. |
pka |
2.06±0.10(Predicted) |
color |
White to Off-White |
Merck |
13,6221 |
InChI |
InChI=1/C8H10N2O4/c9-5(8(13)14)3-10-2-1-6(11)7(12)4-10/h1-2,4-5,12H,3,9H2,(H,13,14)/t5-/s3 |
InChIKey |
WZNJWVWKTVETCG-YFKPBYRVSA-N |
SMILES |
C(N1C=CC(=O)C(O)=C1)[C@H](N)C(=O)O |&1:9,r| |
LogP |
-1.080 (est) |
CAS DataBase Reference |
500-44-7(CAS DataBase Reference) |
EPA Substance Registry System |
Mimosine (500-44-7) |