| Melting point |
302°C |
| Boiling point |
887.9±65.0 °C(Predicted) |
| Density |
2.4120 (estimate) |
| storage temp. |
-20°C Freezer, Under inert atmosphere |
| solubility |
Very slightly soluble in water, slightly soluble in ethanol (96 per cent), very slightly soluble in methylene chloride. It dissolves in dilute solutions of alkali hydroxides. |
| pka |
0.89±0.10(Predicted) |
| color |
White to Off-White |
| Henry's Law Constant |
2.7×1035 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| Major Application |
pharmaceutical (small molecule) |
| InChIKey |
TYYBFXNZMFNZJT-UHFFFAOYSA-N |
| SMILES |
Ic1c(c(c(c(c1C(=O)NCC(=O)Nc2c(c(c(c(c2I)C(=O)O)I)C(=O)NCCO)I)I)C(=O)NC)I)N(C)C(=O)C |
| EPA Substance Registry System |
[(methylamino)carbonyl]benzoyl]amino]acetyl]amino]-5-[[(2-hydroxyethyl)amino]carbonyl]-2,4,6-triiodo- (59017-64-0) |