| Melting point |
273 °C |
| Boiling point |
577.0±60.0 °C(Predicted) |
| Density |
1.6761 (rough estimate) |
| refractive index |
1.6100 (estimate) |
| Flash point |
9℃ |
| storage temp. |
2-8°C |
| solubility |
Very slightly soluble in water, soluble in acetone, sparingly soluble in ethanol (96 per cent). It dissolves in dilute solutions of alkali hydroxides |
| pka |
7.9, 9.2(at 25℃) |
| form |
solid |
| color |
White to Off-White |
| Odor |
wh. or pract. wh. cryst. powd., odorless |
| Water Solubility |
722mg/L(25 ºC) |
| λmax |
318nm(H2O)(lit.) |
| Merck |
14,4781 |
| BRN |
625101 |
| BCS Class |
3,4 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
pharmaceutical (small molecule) |
| InChI |
1S/C7H8ClN3O4S2/c8-4-1-5-7(2-6(4)16(9,12)13)17(14,15)11-3-10-5/h1-2,10-11H,3H2,(H2,9,12,13) |
| InChIKey |
JZUFKLXOESDKRF-UHFFFAOYSA-N |
| SMILES |
NS(=O)(=O)c1cc2c(NCNS2(=O)=O)cc1Cl |
| LogP |
-0.070 |
| CAS DataBase Reference |
58-93-5(CAS DataBase Reference) |
| NIST Chemistry Reference |
6-Chloro-7-sulfamyl-3,4-dihydro-1,2,4-benzothiadiazine-1,1-dioxide(58-93-5) |
| IARC |
2B (Vol. 50, 108) 2016 |
| EPA Substance Registry System |
Hydrochlorothiazide (58-93-5) |